C14H21ClN2O4 — CID 108885416
1-[(4-chlorophenoxy)methyl]-3-(2,2-diethoxyethyl)urea (PubChem CID 108885416) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.78 g/mol. Its IUPAC name is 1-[(4-chlorophenoxy)methyl]-3-(2,2-diethoxyethyl)urea.
| Compound Name | 1-[(4-chlorophenoxy)methyl]-3-(2,2-diethoxyethyl)urea |
|---|---|
| PubChem CID | 108885416 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-[(4-chlorophenoxy)methyl]-3-(2,2-diethoxyethyl)urea |
| SMILES | CCOC(CNC(=O)NCOc1ccc(Cl)cc1)OCC |
| InChI | InChI=1S/C14H21ClN2O4/c1-3-19-13(20-4-2)9-16-14(18)17-10-21-12-7-5-11(15)6-8-12/h5-8,13H,3-4,9-10H2,1-2H3,(H2,16,17,18) |
| InChIKey | QQFRGNOOKQWTGH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|