C16H26N2O4 — CID 108883305
1-(2,2-diethoxyethyl)-3-(3-phenoxypropyl)urea (PubChem CID 108883305) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3-(3-phenoxypropyl)urea.
| Compound Name | 1-(2,2-diethoxyethyl)-3-(3-phenoxypropyl)urea |
|---|---|
| PubChem CID | 108883305 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3-(3-phenoxypropyl)urea |
| SMILES | CCOC(CNC(=O)NCCCOc1ccccc1)OCC |
| InChI | InChI=1S/C16H26N2O4/c1-3-20-15(21-4-2)13-18-16(19)17-11-8-12-22-14-9-6-5-7-10-14/h5-7,9-10,15H,3-4,8,11-13H2,1-2H3,(H2,17,18,19) |
| InChIKey | YRYFNIYAYBIWIC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|