C13H18N2O5 — CID 107839669
(2S)-2-hydroxy-3-(3-phenoxypropylcarbamoylamino)propanoic acid (PubChem CID 107839669) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-(3-phenoxypropylcarbamoylamino)propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-(3-phenoxypropylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 107839669 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (2S)-2-hydroxy-3-(3-phenoxypropylcarbamoylamino)propanoic acid |
| SMILES | O=C(NCCCOc1ccccc1)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C13H18N2O5/c16-11(12(17)18)9-15-13(19)14-7-4-8-20-10-5-2-1-3-6-10/h1-3,5-6,11,16H,4,7-9H2,(H,17,18)(H2,14,15,19)/t11-/m0/s1 |
| InChIKey | HWNFMPDREVNCLR-NSHDSACASA-N |
| XLogP | 0.20 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|