C9H18N2O5 — CID 107839392
(2S)-2-hydroxy-3-(4-methoxybutylcarbamoylamino)propanoic acid (PubChem CID 107839392) has the molecular formula C9H18N2O5 and a molecular weight of 234.25 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-(4-methoxybutylcarbamoylamino)propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-(4-methoxybutylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 107839392 |
| Molecular Formula | C9H18N2O5 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (2S)-2-hydroxy-3-(4-methoxybutylcarbamoylamino)propanoic acid |
| SMILES | COCCCCNC(=O)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C9H18N2O5/c1-16-5-3-2-4-10-9(15)11-6-7(12)8(13)14/h7,12H,2-6H2,1H3,(H,13,14)(H2,10,11,15)/t7-/m0/s1 |
| InChIKey | SLBQVXRKJGIFDS-ZETCQYMHSA-N |
| XLogP | -0.84 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|