C11H22N2O6 — CID 107841009
(2S)-2-hydroxy-3-[4-(2-methoxyethoxy)butylcarbamoylamino]propanoic acid (PubChem CID 107841009) has the molecular formula C11H22N2O6 and a molecular weight of 278.30 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[4-(2-methoxyethoxy)butylcarbamoylamino]propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-[4-(2-methoxyethoxy)butylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 107841009 |
| Molecular Formula | C11H22N2O6 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (2S)-2-hydroxy-3-[4-(2-methoxyethoxy)butylcarbamoylamino]propanoic acid |
| SMILES | COCCOCCCCNC(=O)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C11H22N2O6/c1-18-6-7-19-5-3-2-4-12-11(17)13-8-9(14)10(15)16/h9,14H,2-8H2,1H3,(H,15,16)(H2,12,13,17)/t9-/m0/s1 |
| InChIKey | KZTUXYRSWGHZNU-VIFPVBQESA-N |
| XLogP | -0.83 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|