C14H28N2O5 — CID 104860994
(2R)-2-[4-(2-methoxyethoxy)butylcarbamoylamino]-3,3-dimethylbutanoic acid (PubChem CID 104860994) has the molecular formula C14H28N2O5 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2R)-2-[4-(2-methoxyethoxy)butylcarbamoylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[4-(2-methoxyethoxy)butylcarbamoylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 104860994 |
| Molecular Formula | C14H28N2O5 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (2R)-2-[4-(2-methoxyethoxy)butylcarbamoylamino]-3,3-dimethylbutanoic acid |
| SMILES | COCCOCCCCNC(=O)N[C@@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H28N2O5/c1-14(2,3)11(12(17)18)16-13(19)15-7-5-6-8-21-10-9-20-4/h11H,5-10H2,1-4H3,(H,17,18)(H2,15,16,19)/t11-/m0/s1 |
| InChIKey | PHPOIBOYUMXSRE-NSHDSACASA-N |
| XLogP | 1.23 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|