C12H24N2O5 — CID 103927895
(2R)-2-[2-(2-methoxyethoxy)ethylcarbamoylamino]-3,3-dimethylbutanoic acid (PubChem CID 103927895) has the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. Its IUPAC name is (2R)-2-[2-(2-methoxyethoxy)ethylcarbamoylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[2-(2-methoxyethoxy)ethylcarbamoylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103927895 |
| Molecular Formula | C12H24N2O5 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2R)-2-[2-(2-methoxyethoxy)ethylcarbamoylamino]-3,3-dimethylbutanoic acid |
| SMILES | COCCOCCNC(=O)N[C@@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O5/c1-12(2,3)9(10(15)16)14-11(17)13-5-6-19-8-7-18-4/h9H,5-8H2,1-4H3,(H,15,16)(H2,13,14,17)/t9-/m0/s1 |
| InChIKey | LSHNBVCHHDZTLG-VIFPVBQESA-N |
| XLogP | 0.45 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|