C9H18N2O3 — CID 43468018
2-(ethylcarbamoylamino)-3,3-dimethylbutanoic acid (PubChem CID 43468018) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-(ethylcarbamoylamino)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(ethylcarbamoylamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 43468018 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 2-(ethylcarbamoylamino)-3,3-dimethylbutanoic acid |
| SMILES | CCNC(=O)NC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C9H18N2O3/c1-5-10-8(14)11-6(7(12)13)9(2,3)4/h6H,5H2,1-4H3,(H,12,13)(H2,10,11,14) |
| InChIKey | OVFKTFKIPACVEC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |