C10H20N2O3S — CID 63960155
(2S)-3,3-dimethyl-2-(2-methylsulfanylethylcarbamoylamino)butanoic acid (PubChem CID 63960155) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-(2-methylsulfanylethylcarbamoylamino)butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-(2-methylsulfanylethylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 63960155 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2S)-3,3-dimethyl-2-(2-methylsulfanylethylcarbamoylamino)butanoic acid |
| SMILES | CSCCNC(=O)N[C@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C10H20N2O3S/c1-10(2,3)7(8(13)14)12-9(15)11-5-6-16-4/h7H,5-6H2,1-4H3,(H,13,14)(H2,11,12,15)/t7-/m1/s1 |
| InChIKey | PWSWYOXZPUOYHT-SSDOTTSWSA-N |
| XLogP | 1.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|