C12H24N2O3 — CID 103927496
(2R)-3,3-dimethyl-2-(3-methylbutylcarbamoylamino)butanoic acid (PubChem CID 103927496) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is (2R)-3,3-dimethyl-2-(3-methylbutylcarbamoylamino)butanoic acid.
| Compound Name | (2R)-3,3-dimethyl-2-(3-methylbutylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 103927496 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (2R)-3,3-dimethyl-2-(3-methylbutylcarbamoylamino)butanoic acid |
| SMILES | CC(C)CCNC(=O)N[C@@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O3/c1-8(2)6-7-13-11(17)14-9(10(15)16)12(3,4)5/h8-9H,6-7H2,1-5H3,(H,15,16)(H2,13,14,17)/t9-/m0/s1 |
| InChIKey | QRJBYUWGXLRJRW-VIFPVBQESA-N |
| XLogP | 1.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |