C12H24N4O4 — CID 83112727
(2S)-2-[2-(dimethylcarbamoylamino)ethylcarbamoylamino]-3,3-dimethylbutanoic acid (PubChem CID 83112727) has the molecular formula C12H24N4O4 and a molecular weight of 288.35 g/mol. Its IUPAC name is (2S)-2-[2-(dimethylcarbamoylamino)ethylcarbamoylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[2-(dimethylcarbamoylamino)ethylcarbamoylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 83112727 |
| Molecular Formula | C12H24N4O4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (2S)-2-[2-(dimethylcarbamoylamino)ethylcarbamoylamino]-3,3-dimethylbutanoic acid |
| SMILES | CN(C)C(=O)NCCNC(=O)N[C@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H24N4O4/c1-12(2,3)8(9(17)18)15-10(19)13-6-7-14-11(20)16(4)5/h8H,6-7H2,1-5H3,(H,14,20)(H,17,18)(H2,13,15,19)/t8-/m1/s1 |
| InChIKey | CETCEMHFHZZVAT-MRVPVSSYSA-N |
| XLogP | 0.06 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|