C17H28N2O4 — CID 108879692
1-(2,2-diethoxyethyl)-3-[(4-propylphenoxy)methyl]urea (PubChem CID 108879692) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3-[(4-propylphenoxy)methyl]urea.
| Compound Name | 1-(2,2-diethoxyethyl)-3-[(4-propylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108879692 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3-[(4-propylphenoxy)methyl]urea |
| SMILES | CCCc1ccc(OCNC(=O)NCC(OCC)OCC)cc1 |
| InChI | InChI=1S/C17H28N2O4/c1-4-7-14-8-10-15(11-9-14)23-13-19-17(20)18-12-16(21-5-2)22-6-3/h8-11,16H,4-7,12-13H2,1-3H3,(H2,18,19,20) |
| InChIKey | JDRUVKRZNSCVIV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|