C18H21N3O3 — CID 108879563
2-amino-N-[(4-propylphenoxy)methylcarbamoyl]benzamide (PubChem CID 108879563) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-amino-N-[(4-propylphenoxy)methylcarbamoyl]benzamide.
| Compound Name | 2-amino-N-[(4-propylphenoxy)methylcarbamoyl]benzamide |
|---|---|
| PubChem CID | 108879563 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-amino-N-[(4-propylphenoxy)methylcarbamoyl]benzamide |
| SMILES | CCCc1ccc(OCNC(=O)NC(=O)c2ccccc2N)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-2-5-13-8-10-14(11-9-13)24-12-20-18(23)21-17(22)15-6-3-4-7-16(15)19/h3-4,6-11H,2,5,12,19H2,1H3,(H2,20,21,22,23) |
| InChIKey | FSHGRLCONWMXLD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|