C23H25N3O2 — CID 108879522
1-(4-aminophenyl)-1-phenyl-3-[(4-propylphenoxy)methyl]urea (PubChem CID 108879522) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-(4-aminophenyl)-1-phenyl-3-[(4-propylphenoxy)methyl]urea.
| Compound Name | 1-(4-aminophenyl)-1-phenyl-3-[(4-propylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108879522 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-(4-aminophenyl)-1-phenyl-3-[(4-propylphenoxy)methyl]urea |
| SMILES | CCCc1ccc(OCNC(=O)N(c2ccccc2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O2/c1-2-6-18-9-15-22(16-10-18)28-17-25-23(27)26(20-7-4-3-5-8-20)21-13-11-19(24)12-14-21/h3-5,7-16H,2,6,17,24H2,1H3,(H,25,27) |
| InChIKey | QQSVLNFJZRAKBB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|