C22H23N3O2 — CID 108870728
1-(4-aminophenyl)-3-[(2,4-dimethylphenoxy)methyl]-1-phenylurea (PubChem CID 108870728) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[(2,4-dimethylphenoxy)methyl]-1-phenylurea.
| Compound Name | 1-(4-aminophenyl)-3-[(2,4-dimethylphenoxy)methyl]-1-phenylurea |
|---|---|
| PubChem CID | 108870728 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-(4-aminophenyl)-3-[(2,4-dimethylphenoxy)methyl]-1-phenylurea |
| SMILES | Cc1ccc(OCNC(=O)N(c2ccccc2)c2ccc(N)cc2)c(C)c1 |
| InChI | InChI=1S/C22H23N3O2/c1-16-8-13-21(17(2)14-16)27-15-24-22(26)25(19-6-4-3-5-7-19)20-11-9-18(23)10-12-20/h3-14H,15,23H2,1-2H3,(H,24,26) |
| InChIKey | XCUMSHPESMSKNS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|