C20H17Cl2N3O2 — CID 108881014
1-(4-aminophenyl)-3-[(2,4-dichlorophenoxy)methyl]-1-phenylurea (PubChem CID 108881014) has the molecular formula C20H17Cl2N3O2 and a molecular weight of 402.28 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[(2,4-dichlorophenoxy)methyl]-1-phenylurea.
| Compound Name | 1-(4-aminophenyl)-3-[(2,4-dichlorophenoxy)methyl]-1-phenylurea |
|---|---|
| PubChem CID | 108881014 |
| Molecular Formula | C20H17Cl2N3O2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 1-(4-aminophenyl)-3-[(2,4-dichlorophenoxy)methyl]-1-phenylurea |
| SMILES | Nc1ccc(N(C(=O)NCOc2ccc(Cl)cc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H17Cl2N3O2/c21-14-6-11-19(18(22)12-14)27-13-24-20(26)25(16-4-2-1-3-5-16)17-9-7-15(23)8-10-17/h1-12H,13,23H2,(H,24,26) |
| InChIKey | DGOCZKOWPYXZES-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|