C15H12Cl2N2O4 — CID 108880826
3-[(2,4-dichlorophenoxy)methylcarbamoylamino]benzoic acid (PubChem CID 108880826) has the molecular formula C15H12Cl2N2O4 and a molecular weight of 355.18 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenoxy)methylcarbamoylamino]benzoic acid.
| Compound Name | 3-[(2,4-dichlorophenoxy)methylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 108880826 |
| Molecular Formula | C15H12Cl2N2O4 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 3-[(2,4-dichlorophenoxy)methylcarbamoylamino]benzoic acid |
| SMILES | O=C(NCOc1ccc(Cl)cc1Cl)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H12Cl2N2O4/c16-10-4-5-13(12(17)7-10)23-8-18-15(22)19-11-3-1-2-9(6-11)14(20)21/h1-7H,8H2,(H,20,21)(H2,18,19,22) |
| InChIKey | RBDYGOFCNFKCMZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|