C16H26N2O2 — CID 108870801
1-tert-butyl-3-[(2,4-dimethylphenoxy)methyl]-1-ethylurea (PubChem CID 108870801) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-tert-butyl-3-[(2,4-dimethylphenoxy)methyl]-1-ethylurea.
| Compound Name | 1-tert-butyl-3-[(2,4-dimethylphenoxy)methyl]-1-ethylurea |
|---|---|
| PubChem CID | 108870801 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-tert-butyl-3-[(2,4-dimethylphenoxy)methyl]-1-ethylurea |
| SMILES | CCN(C(=O)NCOc1ccc(C)cc1C)C(C)(C)C |
| InChI | InChI=1S/C16H26N2O2/c1-7-18(16(4,5)6)15(19)17-11-20-14-9-8-12(2)10-13(14)3/h8-10H,7,11H2,1-6H3,(H,17,19) |
| InChIKey | UWOCKMFRLYLBJB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|