C12H17NO2 — CID 965411
2-(2,4-dimethylphenoxy)-N-ethylacetamide (PubChem CID 965411) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-ethylacetamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-ethylacetamide |
|---|---|
| PubChem CID | 965411 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-ethylacetamide |
| SMILES | CCNC(=O)COc1ccc(C)cc1C |
| InChI | InChI=1S/C12H17NO2/c1-4-13-12(14)8-15-11-6-5-9(2)7-10(11)3/h5-7H,4,8H2,1-3H3,(H,13,14) |
| InChIKey | UIRBAWHAGJQMKO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |