C14H22N2O4S — CID 38427451
2-(2,4-dimethylphenoxy)-N-[2-(ethylsulfonylamino)ethyl]acetamide (PubChem CID 38427451) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-[2-(ethylsulfonylamino)ethyl]acetamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-[2-(ethylsulfonylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 38427451 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-[2-(ethylsulfonylamino)ethyl]acetamide |
| SMILES | CCS(=O)(=O)NCCNC(=O)COc1ccc(C)cc1C |
| InChI | InChI=1S/C14H22N2O4S/c1-4-21(18,19)16-8-7-15-14(17)10-20-13-6-5-11(2)9-12(13)3/h5-6,9,16H,4,7-8,10H2,1-3H3,(H,15,17) |
| InChIKey | RWLABQZNNDBRIZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|