C18H20Cl2N2O4S — CID 108572838
2-(2,4-dichlorophenoxy)-N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 108572838) has the molecular formula C18H20Cl2N2O4S and a molecular weight of 431.34 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 108572838 |
| Molecular Formula | C18H20Cl2N2O4S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)COc2ccc(Cl)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C18H20Cl2N2O4S/c1-12-3-6-17(13(2)9-12)27(24,25)22-8-7-21-18(23)11-26-16-5-4-14(19)10-15(16)20/h3-6,9-10,22H,7-8,11H2,1-2H3,(H,21,23) |
| InChIKey | LMIBTWBDNICBTC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|