C21H28N2O4S — CID 108573042
N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]-4-(2-methylphenoxy)butanamide (PubChem CID 108573042) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]-4-(2-methylphenoxy)butanamide.
| Compound Name | N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]-4-(2-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 108573042 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]-4-(2-methylphenoxy)butanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)CCCOc2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C21H28N2O4S/c1-16-10-11-20(18(3)15-16)28(25,26)23-13-12-22-21(24)9-6-14-27-19-8-5-4-7-17(19)2/h4-5,7-8,10-11,15,23H,6,9,12-14H2,1-3H3,(H,22,24) |
| InChIKey | DKBCVTNSQNECRG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|