C18H30N2O4S — CID 55349463
N-(3-butoxypropyl)-3-[(2,4-dimethylphenyl)sulfonylamino]propanamide (PubChem CID 55349463) has the molecular formula C18H30N2O4S and a molecular weight of 370.52 g/mol. Its IUPAC name is N-(3-butoxypropyl)-3-[(2,4-dimethylphenyl)sulfonylamino]propanamide.
| Compound Name | N-(3-butoxypropyl)-3-[(2,4-dimethylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 55349463 |
| Molecular Formula | C18H30N2O4S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-(3-butoxypropyl)-3-[(2,4-dimethylphenyl)sulfonylamino]propanamide |
| SMILES | CCCCOCCCNC(=O)CCNS(=O)(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C18H30N2O4S/c1-4-5-12-24-13-6-10-19-18(21)9-11-20-25(22,23)17-8-7-15(2)14-16(17)3/h7-8,14,20H,4-6,9-13H2,1-3H3,(H,19,21) |
| InChIKey | NTHJSAKURQNTBE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|