C13H20N2O4S — CID 47159796
3-[(2,4-dimethylphenyl)sulfonylamino]-N-methoxy-N-methylpropanamide (PubChem CID 47159796) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenyl)sulfonylamino]-N-methoxy-N-methylpropanamide.
| Compound Name | 3-[(2,4-dimethylphenyl)sulfonylamino]-N-methoxy-N-methylpropanamide |
|---|---|
| PubChem CID | 47159796 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3-[(2,4-dimethylphenyl)sulfonylamino]-N-methoxy-N-methylpropanamide |
| SMILES | CON(C)C(=O)CCNS(=O)(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C13H20N2O4S/c1-10-5-6-12(11(2)9-10)20(17,18)14-8-7-13(16)15(3)19-4/h5-6,9,14H,7-8H2,1-4H3 |
| InChIKey | FPUZNSFFXVMTBP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|