C21H29N3O3S — CID 55437978
N-[[4-(dimethylamino)phenyl]methyl]-3-[(2,4-dimethylphenyl)sulfonylamino]-N-methylpropanamide (PubChem CID 55437978) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-3-[(2,4-dimethylphenyl)sulfonylamino]-N-methylpropanamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-3-[(2,4-dimethylphenyl)sulfonylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 55437978 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-3-[(2,4-dimethylphenyl)sulfonylamino]-N-methylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)N(C)Cc2ccc(N(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C21H29N3O3S/c1-16-6-11-20(17(2)14-16)28(26,27)22-13-12-21(25)24(5)15-18-7-9-19(10-8-18)23(3)4/h6-11,14,22H,12-13,15H2,1-5H3 |
| InChIKey | LNNKPZPRWLWIQQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|