C17H18Br2N2O3S — CID 55334609
N-benzyl-3-[(2,5-dibromophenyl)sulfonylamino]-N-methylpropanamide (PubChem CID 55334609) has the molecular formula C17H18Br2N2O3S and a molecular weight of 490.22 g/mol. Its IUPAC name is N-benzyl-3-[(2,5-dibromophenyl)sulfonylamino]-N-methylpropanamide.
| Compound Name | N-benzyl-3-[(2,5-dibromophenyl)sulfonylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 55334609 |
| Molecular Formula | C17H18Br2N2O3S |
| Molecular Weight | 490.22 g/mol |
| Exact Mass | 487.94 |
| IUPAC Name | N-benzyl-3-[(2,5-dibromophenyl)sulfonylamino]-N-methylpropanamide |
| SMILES | CN(Cc1ccccc1)C(=O)CCNS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C17H18Br2N2O3S/c1-21(12-13-5-3-2-4-6-13)17(22)9-10-20-25(23,24)16-11-14(18)7-8-15(16)19/h2-8,11,20H,9-10,12H2,1H3 |
| InChIKey | CXECEQKLOMRJQP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |