C17H22N2O4S2 — CID 108573067
4-(2-methylphenoxy)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]butanamide (PubChem CID 108573067) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]butanamide.
| Compound Name | 4-(2-methylphenoxy)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 108573067 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-(2-methylphenoxy)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]butanamide |
| SMILES | Cc1ccccc1OCCCC(=O)NCCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-14-6-2-3-7-15(14)23-12-4-8-16(20)18-10-11-19-25(21,22)17-9-5-13-24-17/h2-3,5-7,9,13,19H,4,8,10-12H2,1H3,(H,18,20) |
| InChIKey | BDBKXGZSSQAVDP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|