C11H18N2O4S2 — CID 47454485
tert-butyl N-[2-(thiophen-2-ylsulfonylamino)ethyl]carbamate (PubChem CID 47454485) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl N-[2-(thiophen-2-ylsulfonylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(thiophen-2-ylsulfonylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 47454485 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | tert-butyl N-[2-(thiophen-2-ylsulfonylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C11H18N2O4S2/c1-11(2,3)17-10(14)12-6-7-13-19(15,16)9-5-4-8-18-9/h4-5,8,13H,6-7H2,1-3H3,(H,12,14) |
| InChIKey | FESZVCNCYNBCSE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|