C11H18N2O5S2 — CID 108574842
2-(2-methoxyethoxy)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]acetamide (PubChem CID 108574842) has the molecular formula C11H18N2O5S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 108574842 |
| Molecular Formula | C11H18N2O5S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]acetamide |
| SMILES | COCCOCC(=O)NCCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C11H18N2O5S2/c1-17-6-7-18-9-10(14)12-4-5-13-20(15,16)11-3-2-8-19-11/h2-3,8,13H,4-7,9H2,1H3,(H,12,14) |
| InChIKey | SRSNEGYLJSLFJA-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|