C15H23N3O6S — CID 108574823
N-[2-[(4-acetamidophenyl)sulfonylamino]ethyl]-2-(2-methoxyethoxy)acetamide (PubChem CID 108574823) has the molecular formula C15H23N3O6S and a molecular weight of 373.43 g/mol. Its IUPAC name is N-[2-[(4-acetamidophenyl)sulfonylamino]ethyl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[2-[(4-acetamidophenyl)sulfonylamino]ethyl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 108574823 |
| Molecular Formula | C15H23N3O6S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-[2-[(4-acetamidophenyl)sulfonylamino]ethyl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NCCNS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C15H23N3O6S/c1-12(19)18-13-3-5-14(6-4-13)25(21,22)17-8-7-16-15(20)11-24-10-9-23-2/h3-6,17H,7-11H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | AAJHDFOOCXNFNL-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|