C12H22N4O5S — CID 108574816
N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]-2-(2-methoxyethoxy)acetamide (PubChem CID 108574816) has the molecular formula C12H22N4O5S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 108574816 |
| Molecular Formula | C12H22N4O5S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NCCNS(=O)(=O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C12H22N4O5S/c1-9-12(10(2)16-15-9)22(18,19)14-5-4-13-11(17)8-21-7-6-20-3/h14H,4-8H2,1-3H3,(H,13,17)(H,15,16) |
| InChIKey | AKYACOJMQXMYTJ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|