C7H12ClN3O2S — CID 65033381
N-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 65033381) has the molecular formula C7H12ClN3O2S and a molecular weight of 237.71 g/mol. Its IUPAC name is N-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 65033381 |
| Molecular Formula | C7H12ClN3O2S |
| Molecular Weight | 237.71 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | N-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCCCl |
| InChI | InChI=1S/C7H12ClN3O2S/c1-5-7(6(2)11-10-5)14(12,13)9-4-3-8/h9H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | LGLAERSBBYMFEB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.71 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|