C10H18ClN3O3S — CID 106245504
N-(3-chloro-4-methoxybutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 106245504) has the molecular formula C10H18ClN3O3S and a molecular weight of 295.79 g/mol. Its IUPAC name is N-(3-chloro-4-methoxybutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(3-chloro-4-methoxybutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106245504 |
| Molecular Formula | C10H18ClN3O3S |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-(3-chloro-4-methoxybutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | COCC(Cl)CCNS(=O)(=O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C10H18ClN3O3S/c1-7-10(8(2)14-13-7)18(15,16)12-5-4-9(11)6-17-3/h9,12H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | RHUOGACXPLELEC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|