C11H21N3O3S — CID 103914904
N-(5-methoxypentyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 103914904) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is N-(5-methoxypentyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(5-methoxypentyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 103914904 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(5-methoxypentyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | COCCCCCNS(=O)(=O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C11H21N3O3S/c1-9-11(10(2)14-13-9)18(15,16)12-7-5-4-6-8-17-3/h12H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | COOOTHNSPACMPI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|