C9H15N3O5S — CID 19059821
N-(3-methoxypropyl)-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide (PubChem CID 19059821) has the molecular formula C9H15N3O5S and a molecular weight of 277.30 g/mol. Its IUPAC name is N-(3-methoxypropyl)-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
| Compound Name | N-(3-methoxypropyl)-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 19059821 |
| Molecular Formula | C9H15N3O5S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(3-methoxypropyl)-6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| SMILES | COCCCNS(=O)(=O)c1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H15N3O5S/c1-6-7(8(13)12-9(14)11-6)18(15,16)10-4-3-5-17-2/h10H,3-5H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | SFVYYNLYEURBBA-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|