C9H16N6O2S — CID 106387054
N-(4-azidobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 106387054) has the molecular formula C9H16N6O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is N-(4-azidobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(4-azidobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106387054 |
| Molecular Formula | C9H16N6O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-(4-azidobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C9H16N6O2S/c1-7-9(8(2)14-13-7)18(16,17)12-6-4-3-5-11-15-10/h12H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | CHFSPNGZTLMLDD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|