C14H17ClN4O3S — CID 108571162
4-chloro-N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]benzamide (PubChem CID 108571162) has the molecular formula C14H17ClN4O3S and a molecular weight of 356.84 g/mol. Its IUPAC name is 4-chloro-N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 108571162 |
| Molecular Formula | C14H17ClN4O3S |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 4-chloro-N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]benzamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCCNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN4O3S/c1-9-13(10(2)19-18-9)23(21,22)17-8-7-16-14(20)11-3-5-12(15)6-4-11/h3-6,17H,7-8H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | QOIKYYBTHFYJIQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|