C15H19FN4O3S — CID 108570983
N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]-2-(4-fluorophenyl)acetamide (PubChem CID 108570983) has the molecular formula C15H19FN4O3S and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 108570983 |
| Molecular Formula | C15H19FN4O3S |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]-2-(4-fluorophenyl)acetamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCCNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN4O3S/c1-10-15(11(2)20-19-10)24(22,23)18-8-7-17-14(21)9-12-3-5-13(16)6-4-12/h3-6,18H,7-9H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | DACYVVQKZZNAGQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|