C18H26N4O5S — CID 108574262
3-(3,4-dimethoxyphenyl)-N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]propanamide (PubChem CID 108574262) has the molecular formula C18H26N4O5S and a molecular weight of 410.50 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]propanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 108574262 |
| Molecular Formula | C18H26N4O5S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]propanamide |
| SMILES | COc1ccc(CCC(=O)NCCNS(=O)(=O)c2c(C)n[nH]c2C)cc1OC |
| InChI | InChI=1S/C18H26N4O5S/c1-12-18(13(2)22-21-12)28(24,25)20-10-9-19-17(23)8-6-14-5-7-15(26-3)16(11-14)27-4/h5,7,11,20H,6,8-10H2,1-4H3,(H,19,23)(H,21,22) |
| InChIKey | NVXQTAGPGSQWDX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|