C22H30N2O6S — CID 108574284
3-(3,4-dimethoxyphenyl)-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]propanamide (PubChem CID 108574284) has the molecular formula C22H30N2O6S and a molecular weight of 450.56 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]propanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 108574284 |
| Molecular Formula | C22H30N2O6S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]propanamide |
| SMILES | COc1ccc(CCC(=O)NCCNS(=O)(=O)c2cc(C)c(C)cc2OC)cc1OC |
| InChI | InChI=1S/C22H30N2O6S/c1-15-12-20(30-5)21(13-16(15)2)31(26,27)24-11-10-23-22(25)9-7-17-6-8-18(28-3)19(14-17)29-4/h6,8,12-14,24H,7,9-11H2,1-5H3,(H,23,25) |
| InChIKey | SJCNEIHANDRUPP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|