C21H28N2O5S — CID 108573136
2-(4-ethoxyphenyl)-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 108573136) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 108573136 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | CCOc1ccc(CC(=O)NCCNS(=O)(=O)c2cc(C)c(C)cc2OC)cc1 |
| InChI | InChI=1S/C21H28N2O5S/c1-5-28-18-8-6-17(7-9-18)14-21(24)22-10-11-23-29(25,26)20-13-16(3)15(2)12-19(20)27-4/h6-9,12-13,23H,5,10-11,14H2,1-4H3,(H,22,24) |
| InChIKey | DQGOEVZVBWGPKT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|