C21H23N3O6S — CID 108572092
2-(1,3-dioxoisoindol-2-yl)-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 108572092) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 108572092 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)NCCNC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H23N3O6S/c1-13-10-17(30-3)18(11-14(13)2)31(28,29)23-9-8-22-19(25)12-24-20(26)15-6-4-5-7-16(15)21(24)27/h4-7,10-11,23H,8-9,12H2,1-3H3,(H,22,25) |
| InChIKey | ULPOZGJVUMGPDD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|