C19H16N2O6 — CID 110670967
(2-methoxyphenyl) 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]acetate (PubChem CID 110670967) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is (2-methoxyphenyl) 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]acetate.
| Compound Name | (2-methoxyphenyl) 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 110670967 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (2-methoxyphenyl) 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]acetate |
| SMILES | COc1ccccc1OC(=O)CNC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16N2O6/c1-26-14-8-4-5-9-15(14)27-17(23)10-20-16(22)11-21-18(24)12-6-2-3-7-13(12)19(21)25/h2-9H,10-11H2,1H3,(H,20,22) |
| InChIKey | CDSGNPJSLAMFIK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|