C17H13FN2O4 — CID 110776571
2-(1,3-dioxoisoindol-2-yl)-N-(5-fluoro-2-methoxyphenyl)acetamide (PubChem CID 110776571) has the molecular formula C17H13FN2O4 and a molecular weight of 328.30 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(5-fluoro-2-methoxyphenyl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(5-fluoro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 110776571 |
| Molecular Formula | C17H13FN2O4 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(5-fluoro-2-methoxyphenyl)acetamide |
| SMILES | COc1ccc(F)cc1NC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H13FN2O4/c1-24-14-7-6-10(18)8-13(14)19-15(21)9-20-16(22)11-4-2-3-5-12(11)17(20)23/h2-8H,9H2,1H3,(H,19,21) |
| InChIKey | QFQHYEZZELWVKG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|