C16H10F2N2O3 — CID 2989674
N-(3,5-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 2989674) has the molecular formula C16H10F2N2O3 and a molecular weight of 316.26 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(3,5-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 2989674 |
| Molecular Formula | C16H10F2N2O3 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-(3,5-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H10F2N2O3/c17-9-5-10(18)7-11(6-9)19-14(21)8-20-15(22)12-3-1-2-4-13(12)16(20)23/h1-7H,8H2,(H,19,21) |
| InChIKey | LBFDFPFXIPYVLG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|