C23H16N2O3 — CID 24637025
2-(1,3-dioxoisoindol-2-yl)-N-(9H-fluoren-2-yl)acetamide (PubChem CID 24637025) has the molecular formula C23H16N2O3 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(9H-fluoren-2-yl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(9H-fluoren-2-yl)acetamide |
|---|---|
| PubChem CID | 24637025 |
| Molecular Formula | C23H16N2O3 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(9H-fluoren-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C23H16N2O3/c26-21(13-25-22(27)19-7-3-4-8-20(19)23(25)28)24-16-9-10-18-15(12-16)11-14-5-1-2-6-17(14)18/h1-10,12H,11,13H2,(H,24,26) |
| InChIKey | NHPJUZWGMIEZRT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|