C19H15N3O4 — CID 27421729
2-(1,3-dioxoisoindol-2-yl)-N-(1-methyl-2-oxo-3H-indol-5-yl)acetamide (PubChem CID 27421729) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(1-methyl-2-oxo-3H-indol-5-yl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(1-methyl-2-oxo-3H-indol-5-yl)acetamide |
|---|---|
| PubChem CID | 27421729 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(1-methyl-2-oxo-3H-indol-5-yl)acetamide |
| SMILES | CN1C(=O)Cc2cc(NC(=O)CN3C(=O)c4ccccc4C3=O)ccc21 |
| InChI | InChI=1S/C19H15N3O4/c1-21-15-7-6-12(8-11(15)9-17(21)24)20-16(23)10-22-18(25)13-4-2-3-5-14(13)19(22)26/h2-8H,9-10H2,1H3,(H,20,23) |
| InChIKey | VLTAKQSZKSBQEY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|