C14H16N2O4 — CID 110777123
methyl 4-[(1-methyl-2-oxo-3H-indol-5-yl)amino]-4-oxobutanoate (PubChem CID 110777123) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl 4-[(1-methyl-2-oxo-3H-indol-5-yl)amino]-4-oxobutanoate.
| Compound Name | methyl 4-[(1-methyl-2-oxo-3H-indol-5-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 110777123 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methyl 4-[(1-methyl-2-oxo-3H-indol-5-yl)amino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)Nc1ccc2c(c1)CC(=O)N2C |
| InChI | InChI=1S/C14H16N2O4/c1-16-11-4-3-10(7-9(11)8-13(16)18)15-12(17)5-6-14(19)20-2/h3-4,7H,5-6,8H2,1-2H3,(H,15,17) |
| InChIKey | FKJDCLJZTSBRHT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |