C18H14F2N2O3 — CID 34169021
N-(3,5-difluorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 34169021) has the molecular formula C18H14F2N2O3 and a molecular weight of 344.32 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-(3,5-difluorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 34169021 |
| Molecular Formula | C18H14F2N2O3 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-(3,5-difluorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H14F2N2O3/c19-11-8-12(20)10-13(9-11)21-16(23)6-3-7-22-17(24)14-4-1-2-5-15(14)18(22)25/h1-2,4-5,8-10H,3,6-7H2,(H,21,23) |
| InChIKey | RRFITOILLAWDDP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|