C19H17FN2O3 — CID 29371362
N-(3-fluorophenyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 29371362) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-(3-fluorophenyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 29371362 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-(3-fluorophenyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)Nc1cccc(F)c1)C2=O |
| InChI | InChI=1S/C19H17FN2O3/c1-12-7-8-15-16(10-12)19(25)22(18(15)24)9-3-6-17(23)21-14-5-2-4-13(20)11-14/h2,4-5,7-8,10-11H,3,6,9H2,1H3,(H,21,23) |
| InChIKey | WYCOYPVFCQJCQC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|